C21H18F2N2O3 — CID 162685677
2-[[[4-cyano-7-[4-(1,1-difluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid (PubChem CID 162685677) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is 2-[[[4-cyano-7-[4-(1,1-difluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[4-cyano-7-[4-(1,1-difluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162685677 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-[[[4-cyano-7-[4-(1,1-difluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1cc(-c2ccc(C(C)(F)F)cc2)c2c(c1C#N)CCO2)C(=O)O |
| InChI | InChI=1S/C21H18F2N2O3/c1-12(20(26)27)11-25-18-9-16(19-15(7-8-28-19)17(18)10-24)13-3-5-14(6-4-13)21(2,22)23/h3-6,9,25H,1,7-8,11H2,2H3,(H,26,27) |
| InChIKey | LWXKEPIDUIQNKC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|