C19H16F5N3O3S — CID 162685702
2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxyprop-2-enamide (PubChem CID 162685702) has the molecular formula C19H16F5N3O3S and a molecular weight of 461.41 g/mol. Its IUPAC name is 2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxyprop-2-enamide.
| Compound Name | 2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 162685702 |
| Molecular Formula | C19H16F5N3O3S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[[[4-cyano-7-[4-(pentafluoro-λ6-sulfanyl)phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]-N-hydroxyprop-2-enamide |
| SMILES | C=C(CNc1cc(-c2ccc(S(F)(F)(F)(F)F)cc2)c2c(c1C#N)CCO2)C(=O)NO |
| InChI | InChI=1S/C19H16F5N3O3S/c1-11(19(28)27-29)10-26-17-8-15(18-14(6-7-30-18)16(17)9-25)12-2-4-13(5-3-12)31(20,21,22,23)24/h2-5,8,26,29H,1,6-7,10H2,(H,27,28) |
| InChIKey | DGLKNRDFMZDACB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|