C22H19F3N2O3 — CID 162685725
2-[[[4-cyano-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid (PubChem CID 162685725) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 2-[[[4-cyano-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid.
| Compound Name | 2-[[[4-cyano-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162685725 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-[[[4-cyano-7-[4-[(2S)-1,1,1-trifluoropropan-2-yl]phenyl]-2,3-dihydro-1-benzofuran-5-yl]amino]methyl]prop-2-enoic acid |
| SMILES | C=C(CNc1cc(-c2ccc([C@H](C)C(F)(F)F)cc2)c2c(c1C#N)CCO2)C(=O)O |
| InChI | InChI=1S/C22H19F3N2O3/c1-12(21(28)29)11-27-19-9-17(20-16(7-8-30-20)18(19)10-26)15-5-3-14(4-6-15)13(2)22(23,24)25/h3-6,9,13,27H,1,7-8,11H2,2H3,(H,28,29)/t13-/m0/s1 |
| InChIKey | NINKQCPOUHDTDN-ZDUSSCGKSA-N |
| XLogP | 4.88 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|