(E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid

C8H8F3NO2 — CID 162685803

IUPAC(E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid
SMILESC=C/C(=C\C(=N/C)C(F)(F)F)C(=O)O
InChIInChI=1S/C8H8F3NO2/c1-3-5(7(13)14)4-6(12-2)8(9,10)11/h3-4H,1H2,2H3,(H,13,14)/b5-4+,12-6+
InChIKeyCKPMEMGRGOCRRN-ICLXBRQCSA-N
MW207.15 g/mol
LogP1.82
Rot. Bonds3

About (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid

(E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid (PubChem CID 162685803) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid.

Molecular Properties

Compound Name(E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid
PubChem CID162685803
Molecular FormulaC8H8F3NO2
Molecular Weight207.15 g/mol
Exact Mass207.05
IUPAC Name(E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid
SMILESC=C/C(=C\C(=N/C)C(F)(F)F)C(=O)O
InChIInChI=1S/C8H8F3NO2/c1-3-5(7(13)14)4-6(12-2)8(9,10)11/h3-4H,1H2,2H3,(H,13,14)/b5-4+,12-6+
InChIKeyCKPMEMGRGOCRRN-ICLXBRQCSA-N
XLogP1.82
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.15
LogP ≤ 51.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid?
The IUPAC name of (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid (CID 162685803) is (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid.
What is the SMILES notation for (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid?
The canonical SMILES for (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid is C=C/C(=C\C(=N/C)C(F)(F)F)C(=O)O.
What is the InChIKey of (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid?
The InChIKey is CKPMEMGRGOCRRN-ICLXBRQCSA-N. The full InChI is InChI=1S/C8H8F3NO2/c1-3-5(7(13)14)4-6(12-2)8(9,10)11/h3-4H,1H2,2H3,(H,13,14)/b5-4+,12-6+.
What are the key properties of (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid?
(E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid has a molecular weight of 207.15 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethenyl-5,5,5-trifluoro-4-methyliminopent-2-enoic acid is sourced from PubChem (CID 162685803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).