C10H7F4NO2 — CID 162686696
3-(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-2,4-dione (PubChem CID 162686696) has the molecular formula C10H7F4NO2 and a molecular weight of 249.16 g/mol. Its IUPAC name is 3-(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-2,4-dione.
| Compound Name | 3-(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 162686696 |
| Molecular Formula | C10H7F4NO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C10H7F4NO2/c1-3(16)5(4(2)17)6-7(11)9(13)15-10(14)8(6)12/h5H,1-2H3 |
| InChIKey | SLQGFNAQOCQKDS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|