About ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate
ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate (PubChem CID 162686857) has the molecular formula C13H20F3NO5
and a molecular weight of 327.30 g/mol. Its IUPAC name is ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate |
| PubChem CID | 162686857 |
| Molecular Formula | C13H20F3NO5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)CC(=O)N(C)CC(CC(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C13H20F3NO5/c1-4-21-11(19)6-10(18)17(3)8-9(7-13(14,15)16)12(20)22-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | FLQIFWRBNZYWRB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate?
The IUPAC name of ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate (CID 162686857) is ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate.
What is the SMILES notation for ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate?
The canonical SMILES for ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate is CCOC(=O)CC(=O)N(C)CC(CC(F)(F)F)C(=O)OCC.
What is the InChIKey of ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate?
The InChIKey is FLQIFWRBNZYWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3NO5/c1-4-21-11(19)6-10(18)17(3)8-9(7-13(14,15)16)12(20)22-5-2/h9H,4-8H2,1-3H3.
What are the key properties of ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate?
ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate has a molecular weight of 327.30 g/mol, XLogP of 1.53, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(3-ethoxy-3-oxopropanoyl)-methylamino]methyl]-4,4,4-trifluorobutanoate is sourced from PubChem (CID 162686857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).