C27H24F3N5O2S — CID 162687234
4,4-difluoro-2-(4-fluorophenyl)-N-[4-[5-methyl-3-(2-methyl-1,3-thiazol-5-yl)-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl]-2-pyridinyl]butanamide (PubChem CID 162687234) has the molecular formula C27H24F3N5O2S and a molecular weight of 539.58 g/mol. Its IUPAC name is 4,4-difluoro-2-(4-fluorophenyl)-N-[4-[5-methyl-3-(2-methyl-1,3-thiazol-5-yl)-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl]-2-pyridinyl]butanamide.
| Compound Name | 4,4-difluoro-2-(4-fluorophenyl)-N-[4-[5-methyl-3-(2-methyl-1,3-thiazol-5-yl)-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl]-2-pyridinyl]butanamide |
|---|---|
| PubChem CID | 162687234 |
| Molecular Formula | C27H24F3N5O2S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 4,4-difluoro-2-(4-fluorophenyl)-N-[4-[5-methyl-3-(2-methyl-1,3-thiazol-5-yl)-4-oxo-6,7-dihydro-1H-pyrrolo[3,2-c]pyridin-2-yl]-2-pyridinyl]butanamide |
| SMILES | Cc1ncc(-c2c(-c3ccnc(NC(=O)C(CC(F)F)c4ccc(F)cc4)c3)[nH]c3c2C(=O)N(C)CC3)s1 |
| InChI | InChI=1S/C27H24F3N5O2S/c1-14-32-13-20(38-14)24-23-19(8-10-35(2)27(23)37)33-25(24)16-7-9-31-22(11-16)34-26(36)18(12-21(29)30)15-3-5-17(28)6-4-15/h3-7,9,11,13,18,21,33H,8,10,12H2,1-2H3,(H,31,34,36) |
| InChIKey | OPOQBSCRYUUEBT-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |