About 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one
2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 162687809) has the molecular formula C8H9N5O2
and a molecular weight of 207.19 g/mol. Its IUPAC name is 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 162687809 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CO/N=C/c1c[nH]c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C8H9N5O2/c1-15-11-3-4-2-10-6-5(4)7(14)13-8(9)12-6/h2-3H,1H3,(H4,9,10,12,13,14)/b11-3+ |
| InChIKey | HHDPJSNMORKRLW-QDEBKDIKSA-N |
| XLogP | -0.19 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (CID 162687809) is 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is CO/N=C/c1c[nH]c2nc(N)[nH]c(=O)c12.
What is the InChIKey of 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is HHDPJSNMORKRLW-QDEBKDIKSA-N. The full InChI is InChI=1S/C8H9N5O2/c1-15-11-3-4-2-10-6-5(4)7(14)13-8(9)12-6/h2-3H,1H3,(H4,9,10,12,13,14)/b11-3+.
What are the key properties of 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 207.19 g/mol, XLogP of -0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[(E)-methoxyiminomethyl]-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 162687809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).