About (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol
(1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 162687856) has the molecular formula C16H13F3N2O3
and a molecular weight of 338.29 g/mol. Its IUPAC name is (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 162687856 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C[C@@H](O)[C@@H]2Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N2O3/c17-16(18,19)10-2-1-3-11(8-10)20-15-13-5-4-12(21(23)24)6-9(13)7-14(15)22/h1-6,8,14-15,20,22H,7H2/t14-,15-/m1/s1 |
| InChIKey | YJGCBXRXMZRYIS-HUUCEWRRSA-N |
| XLogP | 3.68 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol (CID 162687856) is (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol is O=[N+]([O-])c1ccc2c(c1)C[C@@H](O)[C@@H]2Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol?
The InChIKey is YJGCBXRXMZRYIS-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H13F3N2O3/c17-16(18,19)10-2-1-3-11(8-10)20-15-13-5-4-12(21(23)24)6-9(13)7-14(15)22/h1-6,8,14-15,20,22H,7H2/t14-,15-/m1/s1.
What are the key properties of (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol?
(1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol has a molecular weight of 338.29 g/mol, XLogP of 3.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-5-nitro-1-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 162687856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).