C19H17F3N2O2 — CID 162687880
N-[(2R,3R)-2-hydroxy-3-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 162687880) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-[(2R,3R)-2-hydroxy-3-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | N-[(2R,3R)-2-hydroxy-3-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 162687880 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[(2R,3R)-2-hydroxy-3-[3-(trifluoromethyl)anilino]-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)[C@@H](Nc1cccc(C(F)(F)F)c1)[C@H](O)C2 |
| InChI | InChI=1S/C19H17F3N2O2/c1-2-17(26)23-14-7-6-11-8-16(25)18(15(11)10-14)24-13-5-3-4-12(9-13)19(20,21)22/h2-7,9-10,16,18,24-25H,1,8H2,(H,23,26)/t16-,18-/m1/s1 |
| InChIKey | KMYBMZVOBYIPEA-SJLPKXTDSA-N |
| XLogP | 3.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|