C18H16F2N2O — CID 162687923
N-[1-(3,5-difluoroanilino)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide (PubChem CID 162687923) has the molecular formula C18H16F2N2O and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[1-(3,5-difluoroanilino)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide.
| Compound Name | N-[1-(3,5-difluoroanilino)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 162687923 |
| Molecular Formula | C18H16F2N2O |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[1-(3,5-difluoroanilino)-2,3-dihydro-1H-inden-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)CCC2Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H16F2N2O/c1-2-18(23)22-14-4-5-16-11(7-14)3-6-17(16)21-15-9-12(19)8-13(20)10-15/h2,4-5,7-10,17,21H,1,3,6H2,(H,22,23) |
| InChIKey | IYMJIASLOPFCFK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|