C16H22 — CID 162687974
1,6-dimethyl-2,3-dihydro-1H-indene;2-methylbuta-1,3-diene (PubChem CID 162687974) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,6-dimethyl-2,3-dihydro-1H-indene;2-methylbuta-1,3-diene.
| Compound Name | 1,6-dimethyl-2,3-dihydro-1H-indene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 162687974 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1,6-dimethyl-2,3-dihydro-1H-indene;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.Cc1ccc2c(c1)C(C)CC2 |
| InChI | InChI=1S/C11H14.C5H8/c1-8-3-5-10-6-4-9(2)11(10)7-8;1-4-5(2)3/h3,5,7,9H,4,6H2,1-2H3;4H,1-2H2,3H3 |
| InChIKey | XAWDOSZVHLPRPT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|