C24H23N5O2S — CID 162688125
(3aS,6aR)-N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide (PubChem CID 162688125) has the molecular formula C24H23N5O2S and a molecular weight of 445.55 g/mol. Its IUPAC name is (3aS,6aR)-N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 162688125 |
| Molecular Formula | C24H23N5O2S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (3aS,6aR)-N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole-5-carboxamide |
| SMILES | Cc1cc(-c2sc(NC(=O)N3C[C@H]4COC[C@H]4C3)nc2-c2cccc(C#N)c2)cc(C)n1 |
| InChI | InChI=1S/C24H23N5O2S/c1-14-6-18(7-15(2)26-14)22-21(17-5-3-4-16(8-17)9-25)27-23(32-22)28-24(30)29-10-19-12-31-13-20(19)11-29/h3-8,19-20H,10-13H2,1-2H3,(H,27,28,30)/t19-,20+ |
| InChIKey | ZGZRBBNOZYBCCN-BGYRXZFFSA-N |
| XLogP | 4.47 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |