C24H22F2N6O2S — CID 162688142
(4aS,7aS)-N-[4-(3-cyanophenyl)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-1,3-thiazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxamide (PubChem CID 162688142) has the molecular formula C24H22F2N6O2S and a molecular weight of 496.54 g/mol. Its IUPAC name is (4aS,7aS)-N-[4-(3-cyanophenyl)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-1,3-thiazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aS,7aS)-N-[4-(3-cyanophenyl)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-1,3-thiazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 162688142 |
| Molecular Formula | C24H22F2N6O2S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (4aS,7aS)-N-[4-(3-cyanophenyl)-5-[2-(difluoromethyl)-6-methyl-4-pyridinyl]-1,3-thiazol-2-yl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
| SMILES | Cc1cc(-c2sc(NC(=O)N3C[C@@H]4NCCO[C@H]4C3)nc2-c2cccc(C#N)c2)cc(C(F)F)n1 |
| InChI | InChI=1S/C24H22F2N6O2S/c1-13-7-16(9-17(29-13)22(25)26)21-20(15-4-2-3-14(8-15)10-27)30-23(35-21)31-24(33)32-11-18-19(12-32)34-6-5-28-18/h2-4,7-9,18-19,22,28H,5-6,11-12H2,1H3,(H,30,31,33)/t18-,19-/m0/s1 |
| InChIKey | XITWFGRWJCCJDS-OALUTQOASA-N |
| XLogP | 4.19 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |