C25H25N7O2S — CID 162688170
N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidine-2-carboxamide (PubChem CID 162688170) has the molecular formula C25H25N7O2S and a molecular weight of 487.59 g/mol. Its IUPAC name is N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidine-2-carboxamide.
| Compound Name | N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 162688170 |
| Molecular Formula | C25H25N7O2S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | N-[4-(3-cyanophenyl)-5-(2,6-dimethyl-4-pyridinyl)-1,3-thiazol-2-yl]-6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrazino[1,2-c]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(-c2sc(NC(=O)N3CCN4C(=O)NCCC4C3)nc2-c2cccc(C#N)c2)cc(C)n1 |
| InChI | InChI=1S/C25H25N7O2S/c1-15-10-19(11-16(2)28-15)22-21(18-5-3-4-17(12-18)13-26)29-23(35-22)30-25(34)31-8-9-32-20(14-31)6-7-27-24(32)33/h3-5,10-12,20H,6-9,14H2,1-2H3,(H,27,33)(H,29,30,34) |
| InChIKey | PFIXFMQGZXUBAZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |