C21H19ClN6O2S2 — CID 162688247
N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-imino-1-oxo-1,4-thiazinane-4-carboxamide (PubChem CID 162688247) has the molecular formula C21H19ClN6O2S2 and a molecular weight of 487.01 g/mol. Its IUPAC name is N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-imino-1-oxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-imino-1-oxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 162688247 |
| Molecular Formula | C21H19ClN6O2S2 |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]-1-imino-1-oxo-1,4-thiazinane-4-carboxamide |
| SMILES | [H]N=S1(=O)CCN(C(=O)Nc2nc(-c3cccc(C#N)c3)c(-c3cc(C)nc(Cl)c3)s2)CC1 |
| InChI | InChI=1S/C21H19ClN6O2S2/c1-13-9-16(11-17(22)25-13)19-18(15-4-2-3-14(10-15)12-23)26-20(31-19)27-21(29)28-5-7-32(24,30)8-6-28/h2-4,9-11,24H,5-8H2,1H3,(H,26,27,29) |
| InChIKey | QPLLPYGGXOXLLN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|