C21H18ClN5OS — CID 162688319
N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide (PubChem CID 162688319) has the molecular formula C21H18ClN5OS and a molecular weight of 423.93 g/mol. Its IUPAC name is N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 162688319 |
| Molecular Formula | C21H18ClN5OS |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[5-(2-chloro-6-methyl-4-pyridinyl)-4-(3-cyanophenyl)-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide |
| SMILES | Cc1cc(-c2sc(NC(=O)N3CCCC3)nc2-c2cccc(C#N)c2)cc(Cl)n1 |
| InChI | InChI=1S/C21H18ClN5OS/c1-13-9-16(11-17(22)24-13)19-18(15-6-4-5-14(10-15)12-23)25-20(29-19)26-21(28)27-7-2-3-8-27/h4-6,9-11H,2-3,7-8H2,1H3,(H,25,26,28) |
| InChIKey | IFELMDLQEYWGOA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|