C27H31ClN4O3 — CID 162688899
N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-(4-formylpiperidin-1-yl)pyridine-3-carboxamide (PubChem CID 162688899) has the molecular formula C27H31ClN4O3 and a molecular weight of 495.02 g/mol. Its IUPAC name is N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-(4-formylpiperidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-(4-formylpiperidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162688899 |
| Molecular Formula | C27H31ClN4O3 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-6-(4-formylpiperidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(N3CCC(C=O)CC3)nc2)C(C)(C)C1Oc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C27H31ClN4O3/c1-26(2)24(27(3,4)25(26)35-20-7-5-18(14-29)21(28)13-20)31-23(34)19-6-8-22(30-15-19)32-11-9-17(16-33)10-12-32/h5-8,13,15-17,24-25H,9-12H2,1-4H3,(H,31,34) |
| InChIKey | RGVOONPZUYIDFB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|