C22H24F3N3O3 — CID 162688974
11-hydroxy-7,8-dimethyl-3-(2-methylphenyl)-4-(2,2,2-trifluoroethyl)-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione (PubChem CID 162688974) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is 11-hydroxy-7,8-dimethyl-3-(2-methylphenyl)-4-(2,2,2-trifluoroethyl)-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione.
| Compound Name | 11-hydroxy-7,8-dimethyl-3-(2-methylphenyl)-4-(2,2,2-trifluoroethyl)-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 162688974 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 11-hydroxy-7,8-dimethyl-3-(2-methylphenyl)-4-(2,2,2-trifluoroethyl)-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
| SMILES | Cc1ccccc1C1C(CC(F)(F)F)CCC2(C)N(C)C(=O)c3c(O)c(=O)ccn3N12 |
| InChI | InChI=1S/C22H24F3N3O3/c1-13-6-4-5-7-15(13)17-14(12-22(23,24)25)8-10-21(2)26(3)20(31)18-19(30)16(29)9-11-27(18)28(17)21/h4-7,9,11,14,17,30H,8,10,12H2,1-3H3 |
| InChIKey | PVCXIETUSNAOIV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |