C29H33ClN4O7S — CID 162689872
2-[5-[2-chloro-6-cyano-4-[2-[4-[[2-(methanesulfonamido)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid (PubChem CID 162689872) has the molecular formula C29H33ClN4O7S and a molecular weight of 617.12 g/mol. Its IUPAC name is 2-[5-[2-chloro-6-cyano-4-[2-[4-[[2-(methanesulfonamido)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid.
| Compound Name | 2-[5-[2-chloro-6-cyano-4-[2-[4-[[2-(methanesulfonamido)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid |
|---|---|
| PubChem CID | 162689872 |
| Molecular Formula | C29H33ClN4O7S |
| Molecular Weight | 617.12 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 2-[5-[2-chloro-6-cyano-4-[2-[4-[[2-(methanesulfonamido)pyrimidin-4-yl]methoxy]phenyl]propan-2-yl]phenoxy]pentoxy]acetic acid |
| SMILES | CC(C)(c1ccc(OCc2ccnc(NS(C)(=O)=O)n2)cc1)c1cc(Cl)c(OCCCCCOCC(=O)O)c(C#N)c1 |
| InChI | InChI=1S/C29H33ClN4O7S/c1-29(2,21-7-9-24(10-8-21)41-18-23-11-12-32-28(33-23)34-42(3,37)38)22-15-20(17-31)27(25(30)16-22)40-14-6-4-5-13-39-19-26(35)36/h7-12,15-16H,4-6,13-14,18-19H2,1-3H3,(H,35,36)(H,32,33,34) |
| InChIKey | HAVXGKGXFFJUAC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.12 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|