C17H21BrN4O — CID 162690613
2-[2-(3-bromophenyl)ethylamino]-N-(7-cyano-7-azabicyclo[2.2.1]heptan-2-yl)acetamide (PubChem CID 162690613) has the molecular formula C17H21BrN4O and a molecular weight of 377.29 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)ethylamino]-N-(7-cyano-7-azabicyclo[2.2.1]heptan-2-yl)acetamide.
| Compound Name | 2-[2-(3-bromophenyl)ethylamino]-N-(7-cyano-7-azabicyclo[2.2.1]heptan-2-yl)acetamide |
|---|---|
| PubChem CID | 162690613 |
| Molecular Formula | C17H21BrN4O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[2-(3-bromophenyl)ethylamino]-N-(7-cyano-7-azabicyclo[2.2.1]heptan-2-yl)acetamide |
| SMILES | N#CN1C2CCC1C(NC(=O)CNCCc1cccc(Br)c1)C2 |
| InChI | InChI=1S/C17H21BrN4O/c18-13-3-1-2-12(8-13)6-7-20-10-17(23)21-15-9-14-4-5-16(15)22(14)11-19/h1-3,8,14-16,20H,4-7,9-10H2,(H,21,23) |
| InChIKey | AXWIQOQDHMERKY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|