C18H21F3N6O — CID 162690627
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 162690627) has the molecular formula C18H21F3N6O and a molecular weight of 394.40 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162690627 |
| Molecular Formula | C18H21F3N6O |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)C1CCN(c3nccc(C(F)(F)F)n3)CC1)C2 |
| InChI | InChI=1S/C18H21F3N6O/c19-18(20,21)15-3-6-23-17(25-15)26-7-4-11(5-8-26)16(28)24-13-9-12-1-2-14(13)27(12)10-22/h3,6,11-14H,1-2,4-5,7-9H2,(H,24,28)/t12-,13+,14+/m0/s1 |
| InChIKey | ABSIJWIPVTYLCC-BFHYXJOUSA-N |
| XLogP | 1.91 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|