C19H17N5OS — CID 162690867
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-pyrrol-1-yl-1,3-benzothiazole-6-carboxamide (PubChem CID 162690867) has the molecular formula C19H17N5OS and a molecular weight of 363.45 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-pyrrol-1-yl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-pyrrol-1-yl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 162690867 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-2-pyrrol-1-yl-1,3-benzothiazole-6-carboxamide |
| SMILES | N#CN1[C@H]2CC[C@@H]1[C@H](NC(=O)c1ccc3nc(-n4cccc4)sc3c1)C2 |
| InChI | InChI=1S/C19H17N5OS/c20-11-24-13-4-6-16(24)15(10-13)21-18(25)12-3-5-14-17(9-12)26-19(22-14)23-7-1-2-8-23/h1-3,5,7-9,13,15-16H,4,6,10H2,(H,21,25)/t13-,15+,16+/m0/s1 |
| InChIKey | XUJGTPLMTYQLFD-NUEKZKHPSA-N |
| XLogP | 2.90 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|