C22H27N5O2 — CID 162690983
N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylpropoxy)-4-(1-methylpyrazol-3-yl)benzamide (PubChem CID 162690983) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylpropoxy)-4-(1-methylpyrazol-3-yl)benzamide.
| Compound Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylpropoxy)-4-(1-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 162690983 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[(1R,2R,4S)-7-cyano-7-azabicyclo[2.2.1]heptan-2-yl]-3-(2-methylpropoxy)-4-(1-methylpyrazol-3-yl)benzamide |
| SMILES | CC(C)COc1cc(C(=O)N[C@@H]2C[C@@H]3CC[C@H]2N3C#N)ccc1-c1ccn(C)n1 |
| InChI | InChI=1S/C22H27N5O2/c1-14(2)12-29-21-10-15(4-6-17(21)18-8-9-26(3)25-18)22(28)24-19-11-16-5-7-20(19)27(16)13-23/h4,6,8-10,14,16,19-20H,5,7,11-12H2,1-3H3,(H,24,28)/t16-,19+,20+/m0/s1 |
| InChIKey | ICQBGIPSMDUUAL-PWIZWCRZSA-N |
| XLogP | 2.94 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|