C29H32N8O3 — CID 162691569
N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[(11-methyl-8-oxo-3,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaen-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 162691569) has the molecular formula C29H32N8O3 and a molecular weight of 540.63 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[(11-methyl-8-oxo-3,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaen-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[(11-methyl-8-oxo-3,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaen-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162691569 |
| Molecular Formula | C29H32N8O3 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[(11-methyl-8-oxo-3,5,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12,14,16-heptaen-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc3c(=O)[nH]c4c(c5ccccc5n4C)c3n2)c(OC)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C29H32N8O3/c1-7-24(38)31-19-14-20(23(40-6)15-22(19)36(4)13-12-35(2)3)32-29-30-16-18-26(33-29)25-17-10-8-9-11-21(17)37(5)27(25)34-28(18)39/h7-11,14-16H,1,12-13H2,2-6H3,(H,31,38)(H,34,39)(H,30,32,33) |
| InChIKey | SVARVJDORLUXSN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|