C40H55GeIrN2O2- — CID 162692293
(Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[10-methyl-4-(4-propan-2-ylbenzene-6-id-1-yl)benzo[h]quinazolin-8-yl]germane (PubChem CID 162692293) has the molecular formula C40H55GeIrN2O2- and a molecular weight of 860.72 g/mol. Its IUPAC name is (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[10-methyl-4-(4-propan-2-ylbenzene-6-id-1-yl)benzo[h]quinazolin-8-yl]germane.
| Compound Name | (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[10-methyl-4-(4-propan-2-ylbenzene-6-id-1-yl)benzo[h]quinazolin-8-yl]germane |
|---|---|
| PubChem CID | 162692293 |
| Molecular Formula | C40H55GeIrN2O2- |
| Molecular Weight | 860.72 g/mol |
| Exact Mass | 862.31 |
| IUPAC Name | (Z)-3,7-diethyl-6-hydroxy-3,7-dimethylnon-5-en-4-one;iridium;trimethyl-[10-methyl-4-(4-propan-2-ylbenzene-6-id-1-yl)benzo[h]quinazolin-8-yl]germane |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1cc([Ge](C)(C)C)cc2ccc3c(-c4[c-]cc(C(C)C)cc4)ncnc3c12.[Ir] |
| InChI | InChI=1S/C25H27GeN2.C15H28O2.Ir/c1-16(2)18-7-9-19(10-8-18)24-22-12-11-20-14-21(26(4,5)6)13-17(3)23(20)25(22)28-15-27-24;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h7-9,11-16H,1-6H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | FRDFPIHXHQLQOI-SWPBDETKSA-N |
| XLogP | 10.87 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.72 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|