C35H43IrN2O2- — CID 162693019
(Z)-3-ethyl-6-hydroxy-3,7,7-trimethyloct-5-en-4-one;iridium;9-methyl-4-phenyl-2-propan-2-ylbenzo[h]quinazoline (PubChem CID 162693019) has the molecular formula C35H43IrN2O2- and a molecular weight of 715.96 g/mol. Its IUPAC name is (Z)-3-ethyl-6-hydroxy-3,7,7-trimethyloct-5-en-4-one;iridium;9-methyl-4-phenyl-2-propan-2-ylbenzo[h]quinazoline.
| Compound Name | (Z)-3-ethyl-6-hydroxy-3,7,7-trimethyloct-5-en-4-one;iridium;9-methyl-4-phenyl-2-propan-2-ylbenzo[h]quinazoline |
|---|---|
| PubChem CID | 162693019 |
| Molecular Formula | C35H43IrN2O2- |
| Molecular Weight | 715.96 g/mol |
| Exact Mass | 716.30 |
| IUPAC Name | (Z)-3-ethyl-6-hydroxy-3,7,7-trimethyloct-5-en-4-one;iridium;9-methyl-4-phenyl-2-propan-2-ylbenzo[h]quinazoline |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(C)C.Cc1ccc2ccc3c(-c4[c-]cccc4)nc(C(C)C)nc3c2c1.[Ir] |
| InChI | InChI=1S/C22H19N2.C13H24O2.Ir/c1-14(2)22-23-20(17-7-5-4-6-8-17)18-12-11-16-10-9-15(3)13-19(16)21(18)24-22;1-7-13(6,8-2)11(15)9-10(14)12(3,4)5;/h4-7,9-14H,1-3H3;9,14H,7-8H2,1-6H3;/q-1;;/b;10-9-; |
| InChIKey | KMYXQHJLYQFJAU-MEILSSRFSA-N |
| XLogP | 9.55 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.96 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|