C33H35F2N5O6 — CID 162695970
(3S,6S)-N-[4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-2,2-difluoro-5-(4-methoxy-1H-indole-2-carbonyl)-5-azaspiro[2.4]heptane-6-carboxamide (PubChem CID 162695970) has the molecular formula C33H35F2N5O6 and a molecular weight of 635.67 g/mol. Its IUPAC name is (3S,6S)-N-[4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-2,2-difluoro-5-(4-methoxy-1H-indole-2-carbonyl)-5-azaspiro[2.4]heptane-6-carboxamide.
| Compound Name | (3S,6S)-N-[4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-2,2-difluoro-5-(4-methoxy-1H-indole-2-carbonyl)-5-azaspiro[2.4]heptane-6-carboxamide |
|---|---|
| PubChem CID | 162695970 |
| Molecular Formula | C33H35F2N5O6 |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | (3S,6S)-N-[4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-2,2-difluoro-5-(4-methoxy-1H-indole-2-carbonyl)-5-azaspiro[2.4]heptane-6-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3C[C@]4(C[C@H]3C(=O)NC(C[C@@H]3CCCNC3=O)C(=O)C(=O)NCc3ccccc3)CC4(F)F)cc12 |
| InChI | InChI=1S/C33H35F2N5O6/c1-46-26-11-5-10-22-21(26)14-24(38-22)31(45)40-18-32(17-33(32,34)35)15-25(40)29(43)39-23(13-20-9-6-12-36-28(20)42)27(41)30(44)37-16-19-7-3-2-4-8-19/h2-5,7-8,10-11,14,20,23,25,38H,6,9,12-13,15-18H2,1H3,(H,36,42)(H,37,44)(H,39,43)/t20-,23?,25-,32-/m0/s1 |
| InChIKey | WNJHJBYZPXZPJC-HZWOYSEUSA-N |
| XLogP | 2.70 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|