About 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole
1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole (PubChem CID 162696132) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole.
Molecular Properties
| Compound Name | 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole |
| PubChem CID | 162696132 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole |
| SMILES | Cn1nc2c(c1C(C)(C)C)c1ccccc1n2C |
| InChI | InChI=1S/C15H19N3/c1-15(2,3)13-12-10-8-6-7-9-11(10)17(4)14(12)16-18(13)5/h6-9H,1-5H3 |
| InChIKey | MKHQZAQMPGIXSF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole?
The IUPAC name of 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole (CID 162696132) is 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole.
What is the SMILES notation for 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole?
The canonical SMILES for 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole is Cn1nc2c(c1C(C)(C)C)c1ccccc1n2C.
What is the InChIKey of 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole?
The InChIKey is MKHQZAQMPGIXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-15(2,3)13-12-10-8-6-7-9-11(10)17(4)14(12)16-18(13)5/h6-9H,1-5H3.
What are the key properties of 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole?
1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole has a molecular weight of 241.34 g/mol, XLogP of 3.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2,4-dimethylpyrazolo[3,4-b]indole is sourced from PubChem (CID 162696132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).