C19H15Cl2N7OS — CID 162696652
1-[(2,6-dichlorophenyl)methyl]-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 162696652) has the molecular formula C19H15Cl2N7OS and a molecular weight of 460.35 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162696652 |
| Molecular Formula | C19H15Cl2N7OS |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NC1CSc2cccn2-n2ccnc21)c1ncn(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C19H15Cl2N7OS/c20-13-3-1-4-14(21)12(13)9-26-11-23-17(25-26)19(29)24-15-10-30-16-5-2-7-27(16)28-8-6-22-18(15)28/h1-8,11,15H,9-10H2,(H,24,29) |
| InChIKey | XCEQGQQSVJFIDF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |