C17H38N2O4Si — CID 162696880
1-ethoxy-2,2,6,6-tetramethyl-N-(3-trimethoxysilylpropyl)piperidin-4-amine (PubChem CID 162696880) has the molecular formula C17H38N2O4Si and a molecular weight of 362.59 g/mol. Its IUPAC name is 1-ethoxy-2,2,6,6-tetramethyl-N-(3-trimethoxysilylpropyl)piperidin-4-amine.
| Compound Name | 1-ethoxy-2,2,6,6-tetramethyl-N-(3-trimethoxysilylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 162696880 |
| Molecular Formula | C17H38N2O4Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 1-ethoxy-2,2,6,6-tetramethyl-N-(3-trimethoxysilylpropyl)piperidin-4-amine |
| SMILES | CCON1C(C)(C)CC(NCCC[Si](OC)(OC)OC)CC1(C)C |
| InChI | InChI=1S/C17H38N2O4Si/c1-9-23-19-16(2,3)13-15(14-17(19,4)5)18-11-10-12-24(20-6,21-7)22-8/h15,18H,9-14H2,1-8H3 |
| InChIKey | ATCCXLSTOQECJO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|