About CID 162696881
CID 162696881 (PubChem CID 162696881) has the molecular formula C18H38N2O2Si
and a molecular weight of 342.60 g/mol.
Molecular Properties
| Compound Name | CID 162696881 |
| PubChem CID | 162696881 |
| Molecular Formula | C18H38N2O2Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | — |
| SMILES | CCOC(OCC)[Si]CCCNC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C18H38N2O2Si/c1-8-21-16(22-9-2)23-12-10-11-19-15-13-17(3,4)20(7)18(5,6)14-15/h15-16,19H,8-14H2,1-7H3 |
| InChIKey | ROQHQPZBKLVSQH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 162696881 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162696881?
The IUPAC name of CID 162696881 (CID 162696881) is not available.
What is the SMILES notation for CID 162696881?
The canonical SMILES for CID 162696881 is CCOC(OCC)[Si]CCCNC1CC(C)(C)N(C)C(C)(C)C1.
What is the InChIKey of CID 162696881?
The InChIKey is ROQHQPZBKLVSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2O2Si/c1-8-21-16(22-9-2)23-12-10-11-19-15-13-17(3,4)20(7)18(5,6)14-15/h15-16,19H,8-14H2,1-7H3.
What are the key properties of CID 162696881?
CID 162696881 has a molecular weight of 342.60 g/mol, XLogP of 3.10, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162696881 is sourced from PubChem (CID 162696881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).