C20H44N2O4Si — CID 162696885
1-ethoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine (PubChem CID 162696885) has the molecular formula C20H44N2O4Si and a molecular weight of 404.67 g/mol. Its IUPAC name is 1-ethoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine.
| Compound Name | 1-ethoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 162696885 |
| Molecular Formula | C20H44N2O4Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 1-ethoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine |
| SMILES | CCON1C(C)(C)CC(NCCC[Si](OCC)(OCC)OCC)CC1(C)C |
| InChI | InChI=1S/C20H44N2O4Si/c1-9-23-22-19(5,6)16-18(17-20(22,7)8)21-14-13-15-27(24-10-2,25-11-3)26-12-4/h18,21H,9-17H2,1-8H3 |
| InChIKey | AGTGALLREIKPHX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|