C19H42N2O4Si — CID 162696894
1-methoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine (PubChem CID 162696894) has the molecular formula C19H42N2O4Si and a molecular weight of 390.64 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine.
| Compound Name | 1-methoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 162696894 |
| Molecular Formula | C19H42N2O4Si |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethyl-N-(3-triethoxysilylpropyl)piperidin-4-amine |
| SMILES | CCO[Si](CCCNC1CC(C)(C)N(OC)C(C)(C)C1)(OCC)OCC |
| InChI | InChI=1S/C19H42N2O4Si/c1-9-23-26(24-10-2,25-11-3)14-12-13-20-17-15-18(4,5)21(22-8)19(6,7)16-17/h17,20H,9-16H2,1-8H3 |
| InChIKey | PGTVVPDIFJPNCP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|