About (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one
(4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one (PubChem CID 162697130) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one.
Molecular Properties
| Compound Name | (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one |
| PubChem CID | 162697130 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one |
| SMILES | CC(C)=CC[C@]1(C(=O)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C13H20O3/c1-9(2)6-7-13(8-10(14)16-13)11(15)12(3,4)5/h6H,7-8H2,1-5H3/t13-/m1/s1 |
| InChIKey | RWVQJQUOLHGHEC-CYBMUJFWSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one?
The IUPAC name of (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one (CID 162697130) is (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one.
What is the SMILES notation for (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one?
The canonical SMILES for (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one is CC(C)=CC[C@]1(C(=O)C(C)(C)C)CC(=O)O1.
What is the InChIKey of (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one?
The InChIKey is RWVQJQUOLHGHEC-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H20O3/c1-9(2)6-7-13(8-10(14)16-13)11(15)12(3,4)5/h6H,7-8H2,1-5H3/t13-/m1/s1.
What are the key properties of (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one?
(4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one has a molecular weight of 224.30 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(2,2-dimethylpropanoyl)-4-(3-methylbut-2-enyl)oxetan-2-one is sourced from PubChem (CID 162697130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).