About benzene-5-ide-1,2-diol;carbanide;cerium(4+)
benzene-5-ide-1,2-diol;carbanide;cerium(4+) (PubChem CID 162697209) has the molecular formula C9H14CeO2
and a molecular weight of 294.33 g/mol. Its IUPAC name is benzene-5-ide-1,2-diol;carbanide;cerium(4+).
Molecular Properties
| Compound Name | benzene-5-ide-1,2-diol;carbanide;cerium(4+) |
| PubChem CID | 162697209 |
| Molecular Formula | C9H14CeO2 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | benzene-5-ide-1,2-diol;carbanide;cerium(4+) |
| SMILES | Oc1c[c-]ccc1O.[CH3-].[CH3-].[CH3-].[Ce+4] |
| InChI | InChI=1S/C6H5O2.3CH3.Ce/c7-5-3-1-2-4-6(5)8;;;;/h1,3-4,7-8H;3*1H3;/q4*-1;+4 |
| InChIKey | KRUPAGXZBVXLHU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-5-ide-1,2-diol;carbanide;cerium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-5-ide-1,2-diol;carbanide;cerium(4+)?
The IUPAC name of benzene-5-ide-1,2-diol;carbanide;cerium(4+) (CID 162697209) is benzene-5-ide-1,2-diol;carbanide;cerium(4+).
What is the SMILES notation for benzene-5-ide-1,2-diol;carbanide;cerium(4+)?
The canonical SMILES for benzene-5-ide-1,2-diol;carbanide;cerium(4+) is Oc1c[c-]ccc1O.[CH3-].[CH3-].[CH3-].[Ce+4].
What is the InChIKey of benzene-5-ide-1,2-diol;carbanide;cerium(4+)?
The InChIKey is KRUPAGXZBVXLHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5O2.3CH3.Ce/c7-5-3-1-2-4-6(5)8;;;;/h1,3-4,7-8H;3*1H3;/q4*-1;+4.
What are the key properties of benzene-5-ide-1,2-diol;carbanide;cerium(4+)?
benzene-5-ide-1,2-diol;carbanide;cerium(4+) has a molecular weight of 294.33 g/mol, XLogP of 2.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-5-ide-1,2-diol;carbanide;cerium(4+) is sourced from PubChem (CID 162697209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).