C28H39N3O3 — CID 162697864
1-[2-[(1R,2S,6S,7S,10S,11R,14R,16R)-14-hydroxy-11-(methoxymethyl)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-3-carbonitrile (PubChem CID 162697864) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 1-[2-[(1R,2S,6S,7S,10S,11R,14R,16R)-14-hydroxy-11-(methoxymethyl)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-3-carbonitrile.
| Compound Name | 1-[2-[(1R,2S,6S,7S,10S,11R,14R,16R)-14-hydroxy-11-(methoxymethyl)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 162697864 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 1-[2-[(1R,2S,6S,7S,10S,11R,14R,16R)-14-hydroxy-11-(methoxymethyl)-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-3-carbonitrile |
| SMILES | COC[C@]12CC[C@@](C)(O)C[C@H]1CC[C@H]1[C@@H]3C4CC4[C@H](C(=O)Cn4ccc(C#N)n4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C28H39N3O3/c1-26(33)9-10-28(16-34-3)17(13-26)4-5-19-22(28)6-8-27(2)24(19)20-12-21(20)25(27)23(32)15-31-11-7-18(14-29)30-31/h7,11,17,19-22,24-25,33H,4-6,8-10,12-13,15-16H2,1-3H3/t17-,19-,20?,21?,22+,24-,25-,26-,27+,28-/m1/s1 |
| InChIKey | JTCOFVYAMKXBGB-MILBNGNESA-N |
| XLogP | 4.22 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |