C26H29NO — CID 162698599
N-tert-butyl-N-(4-tert-butylphenyl)dibenzofuran-4-amine (PubChem CID 162698599) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is N-tert-butyl-N-(4-tert-butylphenyl)dibenzofuran-4-amine.
| Compound Name | N-tert-butyl-N-(4-tert-butylphenyl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 162698599 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-tert-butyl-N-(4-tert-butylphenyl)dibenzofuran-4-amine |
| SMILES | CC(C)(C)c1ccc(N(c2cccc3c2oc2ccccc23)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H29NO/c1-25(2,3)18-14-16-19(17-15-18)27(26(4,5)6)22-12-9-11-21-20-10-7-8-13-23(20)28-24(21)22/h7-17H,1-6H3 |
| InChIKey | LTSKCVAUZWPNMV-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |