C9H18FN3O3S — CID 162699540
2-(2-aminoethylsulfonyl)-2-fluoro-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 162699540) has the molecular formula C9H18FN3O3S and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(2-aminoethylsulfonyl)-2-fluoro-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2-aminoethylsulfonyl)-2-fluoro-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 162699540 |
| Molecular Formula | C9H18FN3O3S |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(2-aminoethylsulfonyl)-2-fluoro-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)C(F)S(=O)(=O)CCN)CC1 |
| InChI | InChI=1S/C9H18FN3O3S/c1-12-3-5-13(6-4-12)9(14)8(10)17(15,16)7-2-11/h8H,2-7,11H2,1H3 |
| InChIKey | IYLMTEVNTCOBEA-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |