About dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate
dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate (PubChem CID 162699850) has the molecular formula C14H8I2K2O6S2
and a molecular weight of 668.35 g/mol. Its IUPAC name is dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate.
Molecular Properties
| Compound Name | dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| PubChem CID | 162699850 |
| Molecular Formula | C14H8I2K2O6S2 |
| Molecular Weight | 668.35 g/mol |
| Exact Mass | 667.71 |
| IUPAC Name | dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cc(I)ccc1/C=C/c1ccc(I)cc1S(=O)(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C14H10I2O6S2.2K/c15-11-5-3-9(13(7-11)23(17,18)19)1-2-10-4-6-12(16)8-14(10)24(20,21)22;;/h1-8H,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2/b2-1+;; |
| InChIKey | OQPOCTJWFVNXTQ-SEPHDYHBSA-L |
| XLogP | -3.12 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 668.35 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate?
The IUPAC name of dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate (CID 162699850) is dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate.
What is the SMILES notation for dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate?
The canonical SMILES for dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate is O=S(=O)([O-])c1cc(I)ccc1/C=C/c1ccc(I)cc1S(=O)(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate?
The InChIKey is OQPOCTJWFVNXTQ-SEPHDYHBSA-L. The full InChI is InChI=1S/C14H10I2O6S2.2K/c15-11-5-3-9(13(7-11)23(17,18)19)1-2-10-4-6-12(16)8-14(10)24(20,21)22;;/h1-8H,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2/b2-1+;;.
What are the key properties of dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate?
dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate has a molecular weight of 668.35 g/mol, XLogP of -3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;5-iodo-2-[(E)-2-(4-iodo-2-sulfonatophenyl)ethenyl]benzenesulfonate is sourced from PubChem (CID 162699850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).