C22H19ClF3N5O4S — CID 162699927
(3R,4S,6R)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 162699927) has the molecular formula C22H19ClF3N5O4S and a molecular weight of 541.94 g/mol. Its IUPAC name is (3R,4S,6R)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (3R,4S,6R)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 162699927 |
| Molecular Formula | C22H19ClF3N5O4S |
| Molecular Weight | 541.94 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | (3R,4S,6R)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-5-ethoxy-2-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | [C-]#[N+]c1ncc(Cl)cc1S[C@H]1OC(CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)C1OCC |
| InChI | InChI=1S/C22H19ClF3N5O4S/c1-3-34-20-18(31-8-14(29-30-31)10-4-12(24)17(26)13(25)5-10)19(33)15(9-32)35-22(20)36-16-6-11(23)7-28-21(16)27-2/h4-8,15,18-20,22,32-33H,3,9H2,1H3/t15?,18-,19-,20?,22+/m0/s1 |
| InChIKey | CJEGMDMGFBDSKJ-GGPAGSKWSA-N |
| XLogP | 3.78 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.94 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|