C22H20ClF2N5O4S — CID 162700036
3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-5-methylpyridine-2-carbonitrile (PubChem CID 162700036) has the molecular formula C22H20ClF2N5O4S and a molecular weight of 523.95 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-5-methylpyridine-2-carbonitrile.
| Compound Name | 3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-5-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 162700036 |
| Molecular Formula | C22H20ClF2N5O4S |
| Molecular Weight | 523.95 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | 3-[(2R,3R,4S,5R,6R)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxyoxan-2-yl]sulfanyl-5-methylpyridine-2-carbonitrile |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@@H]1Sc1cc(C)cnc1C#N |
| InChI | InChI=1S/C22H20ClF2N5O4S/c1-10-3-17(14(6-26)27-7-10)35-22-21(33-2)19(20(32)16(9-31)34-22)30-8-15(28-29-30)11-4-12(24)18(23)13(25)5-11/h3-5,7-8,16,19-22,31-32H,9H2,1-2H3/t16-,19+,20+,21-,22-/m1/s1 |
| InChIKey | RQXUTOIZNUSBSF-WIXLDOGYSA-N |
| XLogP | 2.88 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.95 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|