C22H19BrF6N4O5S — CID 162700138
(3R,4S,6R)-6-[(5-bromo-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-(3,3,3-trifluoro-2-hydroxypropoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol (PubChem CID 162700138) has the molecular formula C22H19BrF6N4O5S and a molecular weight of 645.38 g/mol. Its IUPAC name is (3R,4S,6R)-6-[(5-bromo-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-(3,3,3-trifluoro-2-hydroxypropoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol.
| Compound Name | (3R,4S,6R)-6-[(5-bromo-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-(3,3,3-trifluoro-2-hydroxypropoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
|---|---|
| PubChem CID | 162700138 |
| Molecular Formula | C22H19BrF6N4O5S |
| Molecular Weight | 645.38 g/mol |
| Exact Mass | 644.02 |
| IUPAC Name | (3R,4S,6R)-6-[(5-bromo-3-pyridinyl)sulfanyl]-2-(hydroxymethyl)-5-(3,3,3-trifluoro-2-hydroxypropoxy)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-ol |
| SMILES | OCC1O[C@H](Sc2cncc(Br)c2)C(OCC(O)C(F)(F)F)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C22H19BrF6N4O5S/c23-10-3-11(5-30-4-10)39-21-20(37-8-16(35)22(27,28)29)18(19(36)15(7-34)38-21)33-6-14(31-32-33)9-1-12(24)17(26)13(25)2-9/h1-6,15-16,18-21,34-36H,7-8H2/t15?,16?,18-,19-,20?,21+/m0/s1 |
| InChIKey | PUVXVJVEYQVZLQ-JMCSHKTCSA-N |
| XLogP | 3.24 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|