C15H23ClN2O3 — CID 162700206
1-(aminomethyl)-N-[2-(2,5-dioxocyclopent-3-en-1-yl)ethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 162700206) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 1-(aminomethyl)-N-[2-(2,5-dioxocyclopent-3-en-1-yl)ethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-(aminomethyl)-N-[2-(2,5-dioxocyclopent-3-en-1-yl)ethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162700206 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(aminomethyl)-N-[2-(2,5-dioxocyclopent-3-en-1-yl)ethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NCC1(C(=O)NCCC2C(=O)C=CC2=O)CCCCC1 |
| InChI | InChI=1S/C15H22N2O3.ClH/c16-10-15(7-2-1-3-8-15)14(20)17-9-6-11-12(18)4-5-13(11)19;/h4-5,11H,1-3,6-10,16H2,(H,17,20);1H |
| InChIKey | NXNBBIXYXGNSNN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|