C23H38BN3O5 — CID 162700291
[5-amino-5-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]-6-methoxy-6-oxohexyl]boronic acid (PubChem CID 162700291) has the molecular formula C23H38BN3O5 and a molecular weight of 447.39 g/mol. Its IUPAC name is [5-amino-5-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]-6-methoxy-6-oxohexyl]boronic acid.
| Compound Name | [5-amino-5-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]-6-methoxy-6-oxohexyl]boronic acid |
|---|---|
| PubChem CID | 162700291 |
| Molecular Formula | C23H38BN3O5 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | [5-amino-5-[1-(5,5-dimethyl-3-oxo-2,6,7,8-tetrahydroisoquinolin-8-yl)piperidin-4-yl]-6-methoxy-6-oxohexyl]boronic acid |
| SMILES | COC(=O)C(N)(CCCCB(O)O)C1CCN(C2CCC(C)(C)c3cc(=O)[nH]cc32)CC1 |
| InChI | InChI=1S/C23H38BN3O5/c1-22(2)10-6-19(17-15-26-20(28)14-18(17)22)27-12-7-16(8-13-27)23(25,21(29)32-3)9-4-5-11-24(30)31/h14-16,19,30-31H,4-13,25H2,1-3H3,(H,26,28) |
| InChIKey | XSMGQCHOIZOKLL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|