C22H33BBrNO4 — CID 162700305
2-amino-6-borono-2-[4-(5-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexyl]hexanoic acid (PubChem CID 162700305) has the molecular formula C22H33BBrNO4 and a molecular weight of 466.23 g/mol. Its IUPAC name is 2-amino-6-borono-2-[4-(5-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexyl]hexanoic acid.
| Compound Name | 2-amino-6-borono-2-[4-(5-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexyl]hexanoic acid |
|---|---|
| PubChem CID | 162700305 |
| Molecular Formula | C22H33BBrNO4 |
| Molecular Weight | 466.23 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-amino-6-borono-2-[4-(5-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)cyclohexyl]hexanoic acid |
| SMILES | NC(CCCCB(O)O)(C(=O)O)C1CCC(C2CCCc3c(Br)cccc32)CC1 |
| InChI | InChI=1S/C22H33BBrNO4/c24-20-8-4-6-18-17(5-3-7-19(18)20)15-9-11-16(12-10-15)22(25,21(26)27)13-1-2-14-23(28)29/h4,6,8,15-17,28-29H,1-3,5,7,9-14,25H2,(H,26,27) |
| InChIKey | DXIYKGPDADVSBE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|