C19H24N4O4 — CID 162700348
2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]hexanamide (PubChem CID 162700348) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]hexanamide.
| Compound Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]hexanamide |
|---|---|
| PubChem CID | 162700348 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]hexanamide |
| SMILES | CCCCC(Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C(N)=O |
| InChI | InChI=1S/C19H24N4O4/c1-2-3-6-14(17(20)25)21-13-7-4-5-11-12(13)10-23(19(11)27)15-8-9-16(24)22-18(15)26/h4-5,7,14-15,21H,2-3,6,8-10H2,1H3,(H2,20,25)(H,22,24,26) |
| InChIKey | GRKQFLCXLBACTB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|