C35H43F3O3S — CID 162700737
[2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,8-dimethyl-4,4,6-triphenyldecanoate (PubChem CID 162700737) has the molecular formula C35H43F3O3S and a molecular weight of 600.79 g/mol. Its IUPAC name is [2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,8-dimethyl-4,4,6-triphenyldecanoate.
| Compound Name | [2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,8-dimethyl-4,4,6-triphenyldecanoate |
|---|---|
| PubChem CID | 162700737 |
| Molecular Formula | C35H43F3O3S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | [2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 2,8-dimethyl-4,4,6-triphenyldecanoate |
| SMILES | CCC(C)CC(CC(CC(C)C(=O)OCC(O)CSCC(F)(F)F)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H43F3O3S/c1-4-26(2)20-29(28-14-8-5-9-15-28)22-34(30-16-10-6-11-17-30,31-18-12-7-13-19-31)21-27(3)33(40)41-23-32(39)24-42-25-35(36,37)38/h5-19,26-27,29,32,39H,4,20-25H2,1-3H3 |
| InChIKey | URJTUNPOLPCLAW-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |