C40H51F3O5S — CID 162700741
1-O-[2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 5-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate (PubChem CID 162700741) has the molecular formula C40H51F3O5S and a molecular weight of 700.90 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 5-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate.
| Compound Name | 1-O-[2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 5-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate |
|---|---|
| PubChem CID | 162700741 |
| Molecular Formula | C40H51F3O5S |
| Molecular Weight | 700.90 g/mol |
| Exact Mass | 700.34 |
| IUPAC Name | 1-O-[2-hydroxy-3-(2,2,2-trifluoroethylsulfanyl)propyl] 5-O-methyl 2,4-dimethyl-2-(6-methyl-2,2,4-triphenyloctyl)pentanedioate |
| SMILES | CCC(C)CC(CC(CC(C)(CC(C)C(=O)OC)C(=O)OCC(O)CSCC(F)(F)F)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H51F3O5S/c1-6-29(2)22-32(31-16-10-7-11-17-31)24-39(33-18-12-8-13-19-33,34-20-14-9-15-21-34)27-38(4,23-30(3)36(45)47-5)37(46)48-25-35(44)26-49-28-40(41,42)43/h7-21,29-30,32,35,44H,6,22-28H2,1-5H3 |
| InChIKey | CXNSKSOOEBSZBF-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.90 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |