C11H16F2NO4S- — CID 162701253
2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 162701253) has the molecular formula C11H16F2NO4S- and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 162701253 |
| Molecular Formula | C11H16F2NO4S- |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | O=C(N1CCC2CCCCC2C1)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H17F2NO4S/c12-11(13,19(16,17)18)10(15)14-6-5-8-3-1-2-4-9(8)7-14/h8-9H,1-7H2,(H,16,17,18)/p-1 |
| InChIKey | ZLTXMSHHZMOASJ-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|